Introduction：Basic information about CAS 479-22-1|2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-dinitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-dinitro- |
|---|
| CAS Number | 479-22-1 | Molecular Weight | 230.08900 |
|---|
| Density | 2.1g/cm3 | Boiling Point | 352.3ºC at 760 mmHg |
|---|
| Molecular Formula | C6H2N2O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.2ºC |
|---|
Names
| Name | 2,5-dihydroxy-3,6-dinitrocyclohexa-2,5-diene-1,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.1g/cm3 |
|---|
| Boiling Point | 352.3ºC at 760 mmHg |
|---|
| Molecular Formula | C6H2N2O8 |
|---|
| Molecular Weight | 230.08900 |
|---|
| Flash Point | 159.2ºC |
|---|
| Exact Mass | 229.98100 |
|---|
| PSA | 166.24000 |
|---|
| LogP | 0.27720 |
|---|
| Vapour Pressure | 2.27E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | FDOKWKTVAJNFLT-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C(O)=C([N+](=O)[O-])C(=O)C(O)=C1[N+](=O)[O-] |
|---|
Synonyms
| 3,5-dihydroxyquinone |
| Nitranilic acid |
| 2,6-dinitroquinone |
| p-Benzoquinone,5-dihydroxy-3,6-dinitro |
| HMS3080J21 |
