Introduction：Basic information about CAS 63684-32-2|3,3'-Disulfanediylbis(3-phenylpropanoic acid), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-Disulfanediylbis(3-phenylpropanoic acid) |
|---|
| CAS Number | 63684-32-2 | Molecular Weight | 362.463 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 541.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H18O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.0±30.1 °C |
|---|
Names
| Name | 3-[(2-carboxy-1-phenylethyl)disulfanyl]-3-phenylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 541.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H18O4S2 |
|---|
| Molecular Weight | 362.463 |
|---|
| Flash Point | 281.0±30.1 °C |
|---|
| Exact Mass | 362.064636 |
|---|
| PSA | 125.20000 |
|---|
| LogP | 5.00 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | QEUYTFJIJXIVLP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(SSC(CC(=O)O)c1ccccc1)c1ccccc1 |
|---|
Synonyms
| 3,3'-Dithiobis(3-phenylpropionic) acid |
| 3-[(3-hydroxy-3-oxo-1-phenylpropyl)disulfanyl]-3-phenylpropanoic acid |
| 3,3'-Disulfanediylbis(3-phenylpropanoic acid) |
| Benzenepropanoic acid, β,β'-dithiobis- |
| EINECS 264-412-4 |
