Introduction:Basic information about CAS 34662-32-3|4-Chloro-2-nitrobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-2-nitrobenzonitrile |
|---|
| CAS Number | 34662-32-3 | Molecular Weight | 182.564 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 313.5±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3ClN2O2 | Melting Point | 99-101ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 143.4±23.7 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Chloro-2-nitrobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 313.5±27.0 °C at 760 mmHg |
|---|
| Melting Point | 99-101ºC |
|---|
| Molecular Formula | C7H3ClN2O2 |
|---|
| Molecular Weight | 182.564 |
|---|
| Flash Point | 143.4±23.7 °C |
|---|
| Exact Mass | 181.988312 |
|---|
| PSA | 69.61000 |
|---|
| LogP | 1.97 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | OZKOAADVLVCNFO-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(Cl)cc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-Chloro-2-cyanonitrobenzene |
| EINECS 252-133-0 |
| MFCD00027398 |
| 2-Nitro-4-chlorobenzonitrile |
| 4-Chlor-2-nitro-benzonitril |
| 2-Nitro-4-chlor-benzonitril |
| 4-Chloro-2-nitrobenzonitrile |
| Benzonitrile, 4-chloro-2-nitro- |
| 4-chloro-2-nitro-benzonitrile |
| 4-Chloro-2-nitrobenzonitril |