Introduction：Basic information about CAS 97845-60-8|9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine |
|---|
| CAS Number | 97845-60-8 | Molecular Weight | 355.777 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 575.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18ClN5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 301.5±32.9 °C |
|---|
Names
| Name | 2-(2-(2-Amino-6-chloro-9H-purin-9-yl)ethyl)propane-1,3-diyl diacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 575.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18ClN5O4 |
|---|
| Molecular Weight | 355.777 |
|---|
| Flash Point | 301.5±32.9 °C |
|---|
| Exact Mass | 355.104736 |
|---|
| PSA | 122.22000 |
|---|
| LogP | 0.14 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.640 |
|---|
| InChIKey | KXPSHSVVYGZKAV-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCC(CCn1cnc2c(Cl)nc(N)nc21)COC(C)=O |
|---|
Synonyms
| 1,3-Propanediol, 2-[2-(2-amino-6-chloro-9H-purin-9-yl)ethyl]-, diacetate (ester) |
| 9-(4-acetoxy-3-acetoxymethylbut-1-yl)-2-amino-6-chloropurine |
| [2-(acetyloxymethyl)-4-(2-amino-6-chloropurin-9-yl)butyl] acetate |
| MFCD08458206 |
| 2-(Acetoxymethyl)-4-(2-amino-6-chloro-9H-purin-9-yl)butyl acetate |
| 2-[(acetyloxy)methyl]-4-(2-amino-6-chloro-9H-purin-9-yl)butyl acetate |
| 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine |
| Famciclovir Impurity 1 |
