Introduction:Basic information about CAS 658689-29-3|methyl 3-[(4-methylpiperazin-1-yl)methyl]benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3-[(4-methylpiperazin-1-yl)methyl]benzoate |
|---|
| CAS Number | 658689-29-3 | Molecular Weight | 248.32100 |
|---|
| Density | 1.104g/cm3 | Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.1ºC |
|---|
Names
| Name | methyl 3-[(4-methylpiperazin-1-yl)methyl]benzoate |
|---|
Chemical & Physical Properties
| Density | 1.104g/cm3 |
|---|
| Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20N2O2 |
|---|
| Molecular Weight | 248.32100 |
|---|
| Flash Point | 167.1ºC |
|---|
| Exact Mass | 248.15200 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 1.09640 |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | XXFWNVBCLRIKNP-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc(CN2CCN(C)CC2)c1 |
|---|