Introduction：Basic information about CAS 63914-81-8|2-(Chlorosulfonyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Chlorosulfonyl)benzoic acid |
|---|
| CAS Number | 63914-81-8 | Molecular Weight | 220.630 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 384.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5ClO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.1±23.2 °C |
|---|
Names
| Name | 2-chlorosulfonylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 384.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5ClO4S |
|---|
| Molecular Weight | 220.630 |
|---|
| Flash Point | 186.1±23.2 °C |
|---|
| Exact Mass | 219.959702 |
|---|
| PSA | 79.82000 |
|---|
| LogP | 1.66 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | ZRWICZHXYMHBDP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(Chlorosulfonyl)benzoic acid |
| chlorosulfonyl-benzoic acid |
| chlorosulphonyl-benzoic acid |
| 2-Chlorsulfonyl-benzoesaeure |
| Benzoic acid, 2-(chlorosulfonyl)- |
| 2-chlorosulfonyl benzoic acid |
| 2-chloranylsulfonylbenzoic acid |
