Introduction:Basic information about CAS 6317-85-7|4-Dimethylaminobenzoin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Dimethylaminobenzoin |
|---|
| CAS Number | 6317-85-7 | Molecular Weight | 255.312 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 439.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H17NO2 | Melting Point | 161-163ºC(lit.) |
|---|
| MSDS | / | Flash Point | 219.7±25.9 °C |
|---|
Names
| Name | 4-(dimethylamino)benzoin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 439.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 161-163ºC(lit.) |
|---|
| Molecular Formula | C16H17NO2 |
|---|
| Molecular Weight | 255.312 |
|---|
| Flash Point | 219.7±25.9 °C |
|---|
| Exact Mass | 255.125931 |
|---|
| PSA | 40.54000 |
|---|
| LogP | 2.57 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | SOLBSNQBVLAREX-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc(C(=O)C(O)c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S37-S39 |
|---|
| HS Code | 2922509090 |
|---|
Customs
| HS Code | 2922509090 |
|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1-(4-(Dimethylamino)phenyl)-2-hydroxy-2-phenylethan-1-one |
| 1-(4-(N,N-dimethylamino)phenyl)-2-hydroxy-2-phenylethanone |
| 1-[4-(dimethylamino)phenyl]-2-hydroxy-2-phenyl-ethanon |
| 4-Dimethylaminobenzoin |
| P-DIMETHYLAMINO-A-HYDROXY-A-PHENYLACETOPHENONE |
| 1-[4-(dimethylamino)phenyl]-2-hydroxy-2-phenylethan-1-one |
| 1-[4-(Dimethylamino)phenyl]-2-phenyl-2-hydroxyethanone |
| Ethanone, 1-(4-(dimethylamino)phenyl)-2-hydroxy-2-phenyl- |
| Ethanone, 1-[4-(dimethylamino)phenyl]-2-hydroxy-2-phenyl- |
| 2-Hydroxy-1-[4-(dimethylamino)phenyl]-2-phenylethanone |
| EINECS 228-659-1 |
| 1-[4-(Dimethylamino)phenyl]-2-hydroxy-2-phenylethanone |