Introduction:Basic information about CAS 3337-62-0|3,5-Dibromo-4-hydroxybenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Dibromo-4-hydroxybenzoic acid |
|---|
| CAS Number | 3337-62-0 | Molecular Weight | 295.913 |
|---|
| Density | 2.2±0.1 g/cm3 | Boiling Point | 342.0±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4Br2O3 | Melting Point | 271-274 °C |
|---|
| MSDS | / | Flash Point | 160.6±27.9 °C |
|---|
Names
| Name | 3,5-dibromo-4-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.2±0.1 g/cm3 |
|---|
| Boiling Point | 342.0±42.0 °C at 760 mmHg |
|---|
| Melting Point | 271-274 °C |
|---|
| Molecular Formula | C7H4Br2O3 |
|---|
| Molecular Weight | 295.913 |
|---|
| Flash Point | 160.6±27.9 °C |
|---|
| Exact Mass | 293.852692 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 3.44 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.685 |
|---|
| InChIKey | PHWAJJWKNLWZGJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Br)c(O)c(Br)c1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25-S37/39-S26 |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| DiBrHBz |
| 3,5-Dibrom-4-hydroxy-benzoesaeure |
| 4-hydroxy-3,5-dibromobenzoic acid |
| MFCD00002548 |
| acide dibromo-3,5 hydroxy-4 benzoique |
| 3,5-Dibromo-4-hydroxybenzoic acid |
| QVR DQ CE EE |
| EINECS 222-075-0 |
| Bromoxynilbenzoic acid |
| Benzoic acid,3,5-dibromo-4-hydroxy |
| Benzoic acid, 3,5-dibromo-4-hydroxy- |
| dbha |
| 3,5-dibromo4-hydroxybenzoic acid |
| 3,5-Dibromo-4-hydroxybenzoate |
| Bromoxynylbenzoic acid |