CAS 82354-19-6|Sulforhodamine 101 acid chloride
Introduction：Basic information about CAS 82354-19-6|Sulforhodamine 101 acid chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sulforhodamine 101 acid chloride | ||
|---|---|---|---|
| CAS Number | 82354-19-6 | Molecular Weight | 625.15500 |
| Density | / | Boiling Point | / |
| Molecular Formula | C31H29ClN2O6S2 | Melting Point | / |
| MSDS | USA | Flash Point | / |
| Symbol | GHS07, GHS08 | Signal Word | Danger |
Names
| Name | Texas red |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Molecular Formula | C31H29ClN2O6S2 |
|---|---|
| Molecular Weight | 625.15500 |
| Exact Mass | 624.11600 |
| PSA | 123.58000 |
| LogP | 5.27990 |
| InChIKey | MPLHNVLQVRSVEE-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)Cl)ccc1C1=c2cc3c4c(c2Oc2c1cc1c5c2CCCN5CCC1)CCC[N+]=4CCC3 |
| Storage condition | -20°C |
Safety Information
| Symbol | GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H319-H332-H351-H361d-H372 |
| Precautionary Statements | P201-P261-P304 + P340 + P312-P305 + P351 + P338-P308 + P313 |
| Hazard Codes | Xn |
| Risk Phrases | R20;R40;R48/20/22 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
Articles27
More Articles| Distribution of acetylcholine and catecholamines in fish gills and their potential roles in the hypoxic ventilatory response. Acta Histochem. 115(2) , 158-69, (2013) Carotid body glomus cells in mammals contain a plethora of different neurochemicals. Several hypotheses exist to explain their roles in oxygen-chemosensing. In the present study we assessed the distri... | |
| Cerebellar fastigial nuclear GABAergic projections to the hypothalamus modulate immune function. Brain. Behav. Immun. 27(1) , 80-90, (2013) Our previous work has shown that the cerebellar fastigial nucleus (FN) is involved in modulation of lymphocyte function. Herein, we investigated effect of FN γ-aminobutyric acid (GABA)-ergic projectio... | |
| In vivo evaluation of venular glycocalyx during hemorrhagic shock in rats using intravital microscopy. Microvasc. Res. 85 , 128-33, (2013) Hemorrhage is responsible for a large percentage of trauma-related deaths but the mechanisms underlying tissue ischemia are complex and not well understood. Despite the evidence linking glycocalyx deg... |
Synonyms
| MFCD00012406 |
| Sulforhodamine 640 |
| Sulforhodamine 101 acid chloride |
| Sulforhodamine 101 sulfonyl chloride |
