Introduction：Basic information about CAS 929302-01-2|tert-butyl 9-benzyl-3,9-diazaspiro[5.5]undecane-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 9-benzyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|
| CAS Number | 929302-01-2 | Molecular Weight | 344.491 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 443.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H32N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.1±28.7 °C |
|---|
Names
| Name | Tert-Butyl 9-benzyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 443.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H32N2O2 |
|---|
| Molecular Weight | 344.491 |
|---|
| Flash Point | 222.1±28.7 °C |
|---|
| Exact Mass | 344.246368 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 3.51 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | FZQYTCPFYPQYKV-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(Cc3ccccc3)CC2)CC1 |
|---|
Synonyms
| tert-Butyl-9-benzyl-3,9-diazaspiro[5.5]undecan-3-carboxylat |
| qc-3319 |
| tert-butyl 9-benzyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| 9-benzyl-3,9-diaza-spiro[5.5]undecane-3-carboxylic acid tert-butyl ester |
| 3,9-Diazaspiro[5.5]undecane-3-carboxylic acid, 9-(phenylmethyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 9-benzyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| rw3852 |
