Introduction:Basic information about CAS 476004-80-5|5-Methylthiophene-2-boronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Methylthiophene-2-boronic acid pinacol ester |
|---|
| CAS Number | 476004-80-5 | Molecular Weight | 224.12700 |
|---|
| Density | 0.937 | Boiling Point | 308.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H17BO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 105ºC |
|---|
Names
| Name | 4,4,5,5-tetramethyl-2-(5-methylthiophen-2-yl)-1,3,2-dioxaborolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.937 |
|---|
| Boiling Point | 308.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H17BO2S |
|---|
| Molecular Weight | 224.12700 |
|---|
| Flash Point | 105ºC |
|---|
| Exact Mass | 224.10400 |
|---|
| PSA | 46.70000 |
|---|
| LogP | 2.35570 |
|---|
| Index of Refraction | 1.5 |
|---|
| InChIKey | LTOLNTYOBPPFLS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)s1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 38 |
|---|
| Safety Phrases | S24/25 |
|---|
Synonyms
| 4,4,5,5-tetramethyl-2-(5-methylthiophen-2-yl)-1,3,2-dioxoborolane |
| OR2393 |
| 4,4,5,5-tetramethyl-2-(5-methylthiophen-2-yl)-[1,3,2]dioxaborolane |
| 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-methylthiophene |
| 5-Methylthiophene-2-boronic acid pinacol ester |
| 5-(2-Methylthiophene)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 5-(2-methylthiophene)-4,4,5,5-tetramethyl-1,3,2-dioxoborolane |
| 2-methyl-5-(pinacolboryl)thiophene |
| 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-methylthiophene |