Introduction：Basic information about CAS 71608-10-1|Phenol,3,6-dimethyl-2-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,3,6-dimethyl-2-nitro- |
|---|
| CAS Number | 71608-10-1 | Molecular Weight | 167.16200 |
|---|
| Density | 1.263g/cm3 | Boiling Point | 249ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 107.3ºC |
|---|
Names
| Name | 3,6-Dimethyl-2-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.263g/cm3 |
|---|
| Boiling Point | 249ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO3 |
|---|
| Molecular Weight | 167.16200 |
|---|
| Flash Point | 107.3ºC |
|---|
| Exact Mass | 167.05800 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.44040 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | VIQHHRZADKSPIM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C)c([N+](=O)[O-])c1O |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 6-Nitro-p-xylenol |
| 3-Nitro-2-hydroxy-1,4-dimethyl-benzol |
| 3,6-Dimethyl-2-nitro-phenol |
| Phenol,3,6-dimethyl-2-nitro |
| 3-Nitro-2-oxy-1.4-dimethyl-benzol |
| 3-Nitro-2-hydroxy-p-xylol |
| 2,5-Dimethyl-6-nitrophenol |
