Introduction：Basic information about CAS 64743-08-4|Diclofurime, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diclofurime |
|---|
| CAS Number | 64743-08-4 | Molecular Weight | 385.28500 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 467.057ºC at 760 mmHg |
|---|
| Molecular Formula | C18H22Cl2N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.268ºC |
|---|
Names
| Name | Diclofurime |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 467.057ºC at 760 mmHg |
|---|
| Molecular Formula | C18H22Cl2N2O3 |
|---|
| Molecular Weight | 385.28500 |
|---|
| Flash Point | 236.268ºC |
|---|
| Exact Mass | 384.10100 |
|---|
| PSA | 47.20000 |
|---|
| LogP | 4.70580 |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | VHEJZMZHDUPRNV-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCON=C(c1ccco1)c1ccc(OC)c(Cl)c1Cl |
|---|
Synonyms
| (E)-(2,3-Dichlor-4-methoxyphenyl)-2-furylketon-o-(2-(diethylamino)ethyl)oxim |
| Diclofurima |
| Diclofurimum |
| (E)-(2,3-Dichloro-4-methoxyphenyl) (2-furyl) ketone O-[2-(diethylamino)ethyl]oxime |
| Unii-D1fp3K444h |
