Introduction：Basic information about CAS 47082-97-3|Pargolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pargolol |
|---|
| CAS Number | 47082-97-3 | Molecular Weight | 277.35900 |
|---|
| Density | 1.066g/cm3 | Boiling Point | 418ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.6ºC |
|---|
Names
| Name | Pargolol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.066g/cm3 |
|---|
| Boiling Point | 418ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO3 |
|---|
| Molecular Weight | 277.35900 |
|---|
| Flash Point | 206.6ºC |
|---|
| Exact Mass | 277.16800 |
|---|
| PSA | 50.72000 |
|---|
| LogP | 2.21730 |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | UFNAECVCKNHAKN-UHFFFAOYSA-N |
|---|
| SMILES | C#CCOc1ccccc1OCC(O)CNC(C)(C)C |
|---|
Synonyms
| 1-(tert-Butylamino)-3-[2-(2-propynyloxy)phenoxy]-2-propanol |
| 1-(tert.butylamino)-3-[O-(2-propynyloxy)phenoxy]-2-propanol |
| 1-(2-propargyloxyphenoxy)-2-hydroxy-3-tert-butylamino propane |
