Introduction：Basic information about CAS 7606-29-3|rac Methotrimeprazine Sulfoxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | rac Methotrimeprazine Sulfoxide |
|---|
| CAS Number | 7606-29-3 | Molecular Weight | 344.47100 |
|---|
| Density | 1.255g/cm3 | Boiling Point | 517.376ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 266.7ºC |
|---|
Names
| Name | Methotrimeprazine Sulfoxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.255g/cm3 |
|---|
| Boiling Point | 517.376ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O2S |
|---|
| Molecular Weight | 344.47100 |
|---|
| Flash Point | 266.7ºC |
|---|
| Exact Mass | 344.15600 |
|---|
| PSA | 51.99000 |
|---|
| LogP | 4.44180 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | CUJAZGOWDHBZEI-NAIRFVFPSA-N |
|---|
| SMILES | COc1ccc2c(c1)N(CC(C)CN(C)C)c1ccccc1S2=O |
|---|
Synonyms
| rac MethotriMeprazine Sulfoxide |
| Levomeprozamine 5-Sulfoxide |
| (R)-2-Methoxy-N,N,-trimethyl-5-oxide-10H-phenothiazine-10-propanamine |
| (bR)-2-Methoxy-N,N,b-trimethyl-5-oxide-10H-phenothiazine-10-propanamine |
| Methotrimeprazine 5-Sulfoxide |
