Introduction:Basic information about CAS 57202-76-3|LY 116467, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | LY 116467 |
|---|
| CAS Number | 57202-76-3 | Molecular Weight | 286.43500 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 434ºC at 760mmHg |
|---|
| Molecular Formula | C17H22N2S | Melting Point | >256ºC (dec.) |
|---|
| MSDS | / | Flash Point | 216.3ºC |
|---|
Names
| Name | 6-Methyl Pergolide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 434ºC at 760mmHg |
|---|
| Melting Point | >256ºC (dec.) |
|---|
| Molecular Formula | C17H22N2S |
|---|
| Molecular Weight | 286.43500 |
|---|
| Flash Point | 216.3ºC |
|---|
| Exact Mass | 286.15000 |
|---|
| PSA | 44.33000 |
|---|
| LogP | 3.42880 |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | HEZLHSNBFOCKCQ-UHFFFAOYSA-N |
|---|
| SMILES | CSCC1CC2c3cccc4[nH]cc(c34)CC2N(C)C1 |
|---|
Synonyms
| (6aR,9R,10aR)-7-methyl-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |