Introduction：Basic information about CAS 22808-73-7|Benzoic acid,4-(aminosulfonyl)-, methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,4-(aminosulfonyl)-, methyl ester |
|---|
| CAS Number | 22808-73-7 | Molecular Weight | 215.22600 |
|---|
| Density | 1.377g/cm3 | Boiling Point | 388.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188.7ºC |
|---|
Names
| Name | Methyl 4-Sulfamoylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.377g/cm3 |
|---|
| Boiling Point | 388.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO4S |
|---|
| Molecular Weight | 215.22600 |
|---|
| Flash Point | 188.7ºC |
|---|
| Exact Mass | 215.02500 |
|---|
| PSA | 94.84000 |
|---|
| LogP | 1.90170 |
|---|
| Vapour Pressure | 3.06E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | XLOVNJUCAFIANM-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(S(N)(=O)=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| methyl 4-(aminosulfonyl)benzoate |
| Benzoic acid,4-(aminosulfonyl)-,methyl ester |
| 4-(Aminosulfonyl)benzoic acid methyl ester |
| 4-(carbomethoxyphenyl)sulfonamide |
| 4-(methoxycarbonyl)benzenesulfonamide |
| Methyl p-sulfamylbenzoate |
| Methyl 4-sulphamoylbenzoate |
| 4-sulfamoylbenzoic acid methyl ester |
