Introduction:Basic information about CAS 4526-93-6|Z-SER-GLY-OET, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-SER-GLY-OET |
|---|
| CAS Number | 4526-93-6 | Molecular Weight | 324.32900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H20N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethyl 2-[[(2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H20N2O6 |
|---|
| Molecular Weight | 324.32900 |
|---|
| Exact Mass | 324.13200 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 0.73480 |
|---|
| InChIKey | ZOONJGSLKPDXCV-GFCCVEGCSA-N |
|---|
| SMILES | CCOC(=O)CNC(=O)C(CO)NC(=O)OCc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Benzyloxycarbonyl-L-seryl-glycin-aethylester |
| Z-Ser-Gly-OEt |
| N-Benzyloxycarbonyl-L-serylglycine ethyl ester |
| N-Benzyloxycarbonyl-L-seryl-glycin-ethylester |
| N-Benzyloxycarbonyl-Ser-Gly-aethylester |
| Z-serylglycine ethyl ester |
| Z-L-seryl-L-glycine ethyl ester |