Introduction：Basic information about CAS 238098-26-5|2-Methyl-4-heptafluoroisopropylaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4-heptafluoroisopropylaniline |
|---|
| CAS Number | 238098-26-5 | Molecular Weight | 275.16600 |
|---|
| Density | 1.401 g/cm3 | Boiling Point | 199.838ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8F7N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 83.354ºC |
|---|
Names
| Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.401 g/cm3 |
|---|
| Boiling Point | 199.838ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8F7N |
|---|
| Molecular Weight | 275.16600 |
|---|
| Flash Point | 83.354ºC |
|---|
| Exact Mass | 275.05400 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.44780 |
|---|
| Vapour Pressure | 0.335mmHg at 25°C |
|---|
| Index of Refraction | 1.424 |
|---|
| InChIKey | QVAUOEHPYOFAQA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-methyl-4-(heptafluoropropan-2-yl)-aniline |
| 2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]aniline |
| 2-Methyl-4-(1,1,1,2,3,3,3-heptafluoro-2-propyl)aniline |
| 2-Methyl-4-heptafluoroisopropylaniline |
| 2-methyl-4-(perfluoropropan-2-yl)aniline |
| 2-methyl-4-perfluoroisopropylaniline |
| 2-methyl-4-(1,2,2,2-tetrafluoro-1-trifluoromethylethyl)phenylamine |
| I01-9235 |
| 2-methyl-4-(perfluoropropan-2-yl)benzenamine |
| 4-heptafluoro-isopropyl-2-methylaniline |
| 4-(heptafluoro-2-propyl)-2-methylaniline |
