Introduction：Basic information about CAS 22236-07-3|3-(Difluoromethoxy)nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Difluoromethoxy)nitrobenzene |
|---|
| CAS Number | 22236-07-3 | Molecular Weight | 189.116 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 250.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5F2NO3 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | 105.3±24.6 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-(difluoromethoxy)-3-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 250.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5F2NO3 |
|---|
| Molecular Weight | 189.116 |
|---|
| Flash Point | 105.3±24.6 °C |
|---|
| Exact Mass | 189.023743 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | NYVCZALWNPMMSQ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(OC(F)F)c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2909309090 |
|---|
Preparation
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Difluoromethyl 3-nitrophenyl ether |
| 3-Nitro-α,α-difluoroanisole |
| 3-(Difluoromethoxy)nitrobenzene |
| 3-Difluormethoxy-nitrobenzol |
| MFCD03407974 |
| Benzene, 1-(difluoromethoxy)-3-nitro- |
| 1-(Difluoromethoxy)-3-nitrobenzene |
| 3-difluoromethoxynitrobenzene |
| <3-Nitrophenyl>-difluormethylether |
