Introduction：Basic information about CAS 773-15-9|trifluoro-3-trifluoromethyl-1,2-oxathietane-2,2-dioxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trifluoro-3-trifluoromethyl-1,2-oxathietane-2,2-dioxide |
|---|
| CAS Number | 773-15-9 | Molecular Weight | 230.08600 |
|---|
| Density | 1.93g/cm3 | Boiling Point | 46.5ºC |
|---|
| Molecular Formula | C3F6O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 53.6ºC |
|---|
Names
| Name | 3,4,4-trifluoro-3-(trifluoromethyl)oxathietane 2,2-dioxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.93g/cm3 |
|---|
| Boiling Point | 46.5ºC |
|---|
| Molecular Formula | C3F6O3S |
|---|
| Molecular Weight | 230.08600 |
|---|
| Flash Point | 53.6ºC |
|---|
| Exact Mass | 229.94700 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 2.24810 |
|---|
| Index of Refraction | 1.343 |
|---|
| InChIKey | NRSBEUZIEWSRKT-UHFFFAOYSA-N |
|---|
| SMILES | O=S1(=O)OC(F)(F)C1(F)C(F)(F)F |
|---|
| Storage condition | Keep Cold |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | UN 1760 |
|---|
Synonyms
| MFCD00082475 |
| hexafluorpropansulton |
| PC9181 |
| trifluoro-3-trifluoromethyl-1,2-oxathietane-2,2-dioxide |
| 1,2,2-trifluoro-2-hydroxy-1-trifluoromethylethanesulfonic acid sultone |
| 3-trifluoromethyltrifluoro-1,2-oxathietane 2,2-dioxide |
