Introduction：Basic information about CAS 82510-98-3|4-(trifluoromethyl)benzal chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trifluoromethyl)benzal chloride |
|---|
| CAS Number | 82510-98-3 | Molecular Weight | 229.02700 |
|---|
| Density | 1.4 | Boiling Point | 76/8mm |
|---|
| Molecular Formula | C8H5Cl2F3 | Melting Point | -3ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(dichloromethyl)-4-(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4 |
|---|
| Boiling Point | 76/8mm |
|---|
| Melting Point | -3ºC |
|---|
| Molecular Formula | C8H5Cl2F3 |
|---|
| Molecular Weight | 229.02700 |
|---|
| Exact Mass | 227.97200 |
|---|
| LogP | 4.18160 |
|---|
| InChIKey | GDZMMXXMEMTSJY-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(C(Cl)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| PC1305 |
| MFCD00274358 |
| p-trifluoromethylbenzal chloride |
| 1-dichloromethyl-4-trifluoromethylbenzene |
| para-trifluoromethyl benzal chloride |
