Introduction：Basic information about CAS 65440-41-7|5-bromo-8-nitronaphthalene-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-bromo-8-nitronaphthalene-1-carboxylic acid |
|---|
| CAS Number | 65440-41-7 | Molecular Weight | 296.07400 |
|---|
| Density | 1.804 | Boiling Point | / |
|---|
| Molecular Formula | C11H6BrNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-bromo-8-nitronaphthalene-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.804 |
|---|
| Molecular Formula | C11H6BrNO4 |
|---|
| Molecular Weight | 296.07400 |
|---|
| Exact Mass | 294.94800 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 3.73190 |
|---|
| InChIKey | OLDSMHRBRMMBTJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc2c(Br)ccc([N+](=O)[O-])c12 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-Brom-8-nitro-[1]naphthoesaeure |
| 5-Bromo-8-nitro-1-naphthoicacid |
| 5-Bromo-8-nitro-1-naphthalenecarboxylic acid |
