Introduction:Basic information about CAS 18037-10-0|Trimethylsilanyl-(2-trimethylsilanyloxy-pyrimidin-4-yl)-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trimethylsilanyl-(2-trimethylsilanyloxy-pyrimidin-4-yl)-amine |
|---|
| CAS Number | 18037-10-0 | Molecular Weight | 255.464 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 300.4±34.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H21N3OSi2 | Melting Point | 122ºC |
|---|
| MSDS | / | Flash Point | 135.5±25.7 °C |
|---|
Names
| Name | N-(Trimethylsilyl)-2-[(trimethylsilyl)oxy]pyrimidin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 300.4±34.0 °C at 760 mmHg |
|---|
| Melting Point | 122ºC |
|---|
| Molecular Formula | C10H21N3OSi2 |
|---|
| Molecular Weight | 255.464 |
|---|
| Flash Point | 135.5±25.7 °C |
|---|
| Exact Mass | 255.122314 |
|---|
| PSA | 47.04000 |
|---|
| LogP | 2.01 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.493 |
|---|
| InChIKey | IWEHUWMQLZFGLL-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)Nc1ccnc(O[Si](C)(C)C)n1 |
|---|
Safety Information
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| EINECS 241-945-0 |
| Bis-(Trimethylsilyl) Cytosine (BSC) |
| 2,4-O,N-bis(trimethylsilyl)cytosine |
| N-(Trimethylsilyl)-2-[(trimethylsilyl)oxy]pyrimidin-4-amine |
| O,N-bis(trimethylsilyl)cytosine |
| 2,4-Bis(trimethylsilyloxy)pyrimidine |
| 4-Pyrimidinamine, N-(trimethylsilyl)-2-[(trimethylsilyl)oxy]- |
| 2-(Trimethylsiloxy)-4-(trimethylsilylamino)pyrimidine |
| N-(Trimethylsilyl)-2-(trimethylsiloxy)pyrimidine-4-amine |
| Pyrimidine,2-(trimethylsiloxy)-4-[(trimethylsilyl)amino] |
| O2,N4-Bis(trimethylsilyl)cytosine |
| N,O-bis(trimethylsilyl)cytosine |
| N-(Trimethylsilyl)-2-[(trimethylsilyl)oxy]-4-pyrimidinamine |
| n-(trimethylsilyl)-2-[(trimethylsilyl)oxy]-4-pyrimidinamin |
| 4-(trimethylsilylamino)-2-(trimethylsilyloxy)pyrimidine |
| 4-Pyrimidinamine,N-(trimethylsilyl)-2-[(trimethylsilyl)oxy] |
| 2-O,4-N-bis(trimethylsilyl)cytosine |
| BIS(TRIMETHYLSILYL)CYTOSINE |
| MFCD00047357 |