Introduction：Basic information about CAS 522-57-6|Methanone,(6,7-dimethoxy-1-isoquinolinyl)(3,4-dimethoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone,(6,7-dimethoxy-1-isoquinolinyl)(3,4-dimethoxyphenyl)- |
|---|
| CAS Number | 522-57-6 | Molecular Weight | 353.36900 |
|---|
| Density | 1.214g/cm3 | Boiling Point | 537.9ºC at 760mmHg |
|---|
| Molecular Formula | C20H19NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 279.1ºC |
|---|
Names
| Name | (6,7-dimethoxyisoquinolin-1-yl)-(3,4-dimethoxyphenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.214g/cm3 |
|---|
| Boiling Point | 537.9ºC at 760mmHg |
|---|
| Molecular Formula | C20H19NO5 |
|---|
| Molecular Weight | 353.36900 |
|---|
| Flash Point | 279.1ºC |
|---|
| Exact Mass | 353.12600 |
|---|
| PSA | 66.88000 |
|---|
| LogP | 3.50020 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | QJTBIAMBPGGIGI-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)c2nccc3cc(OC)c(OC)cc23)cc1OC |
|---|
Synonyms
| Xanthaline |
| 6,7-Dimethoxy-1-veratroylisoquinoline |
| Papaveraldin |
| Papaveraldine |
| (6,7-Dimethoxy-1-isoquinolyl) (3,4-dimethoxyphenyl) ketone |
