Introduction：Basic information about CAS 18910-19-5|Benzenepropanoic acid,4-acetyl-a-bromo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid,4-acetyl-a-bromo- |
|---|
| CAS Number | 18910-19-5 | Molecular Weight | 271.10700 |
|---|
| Density | 1.519g/cm3 | Boiling Point | 389.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H11BrO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.4ºC |
|---|
Names
| Name | 3-(4-acetylphenyl)-2-bromopropanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.519g/cm3 |
|---|
| Boiling Point | 389.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H11BrO3 |
|---|
| Molecular Weight | 271.10700 |
|---|
| Flash Point | 189.4ºC |
|---|
| Exact Mass | 269.98900 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.27980 |
|---|
| Vapour Pressure | 9.15E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | OTXNYZKECLXPSN-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(CC(Br)C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
