Introduction：Basic information about CAS 7402-77-9|Phenol,4-[(4-methylphenyl)sulfonyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,4-[(4-methylphenyl)sulfonyl]- |
|---|
| CAS Number | 7402-77-9 | Molecular Weight | 248.29800 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 445.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223.4ºC |
|---|
Names
| Name | 4-(4-methylphenyl)sulfonylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 445.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3S |
|---|
| Molecular Weight | 248.29800 |
|---|
| Flash Point | 223.4ºC |
|---|
| Exact Mass | 248.05100 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 3.61420 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | PTARVWLPQZIRCW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(O)cc2)cc1 |
|---|
Synonyms
| 4-hydroxyphenyl-p-toluenesulfonate |
| 4-Methyl-4'-hydroxydiphenylsulfone |
| 4-hydroxyphenyl 4-tolyl sulfone |
| 4-tosylphenol |
