Introduction:Basic information about CAS 773135-60-7|Ethyl 5-bromo-2-(difluoromethoxy)benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 5-bromo-2-(difluoromethoxy)benzoate |
|---|
| CAS Number | 773135-60-7 | Molecular Weight | 295.07700 |
|---|
| Density | 1.511g/cm3 | Boiling Point | 307.095ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9BrF2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.526ºC |
|---|
Names
| Name | Ethyl 5-bromo-2-(difluoromethoxy)benzoate |
|---|
Chemical & Physical Properties
| Density | 1.511g/cm3 |
|---|
| Boiling Point | 307.095ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9BrF2O3 |
|---|
| Molecular Weight | 295.07700 |
|---|
| Flash Point | 139.526ºC |
|---|
| Exact Mass | 293.97000 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.22720 |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | GYEPBYRBWCGUSS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(Br)ccc1OC(F)F |
|---|