Introduction：Basic information about CAS 64294-88-8|Disperse Violet 63, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Disperse Violet 63 |
|---|
| CAS Number | 64294-88-8 | Molecular Weight | 414.84600 |
|---|
| Density | 1.32 | Boiling Point | / |
|---|
| Molecular Formula | C19H19ClN6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-chloro-N-[2-[(2-cyano-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide |
|---|
Chemical & Physical Properties
| Density | 1.32 |
|---|
| Molecular Formula | C19H19ClN6O3 |
|---|
| Molecular Weight | 414.84600 |
|---|
| Exact Mass | 414.12100 |
|---|
| PSA | 126.67000 |
|---|
| LogP | 5.50158 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | CULIYQPRUGMRRT-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2C#N)c(NC(=O)CCl)c1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
