Introduction：Basic information about CAS 63279-36-7|4-Bromo-1-naphthalenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-1-naphthalenesulfonyl chloride |
|---|
| CAS Number | 63279-36-7 | Molecular Weight | 305.575 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 372.6±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrClO2S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 179.1±20.9 °C |
|---|
Names
| Name | 4-Bromonaphthalene-1-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 372.6±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrClO2S |
|---|
| Molecular Weight | 305.575 |
|---|
| Flash Point | 179.1±20.9 °C |
|---|
| Exact Mass | 303.896027 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.25 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | MNBFYZPSEJKTFA-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(Br)c2ccccc12 |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
Synonyms
| 1-Naphthalenesulfonyl chloride, 4-bromo- |
| 4-bromo-1-naphthylsulphonyl chloride |
| 4-bromonaphthalen-1-sulfonyl chloride |
| 4-Bromonaphthalene-1-sulfonyl chloride |
| 4-Brom-naphthalin-1-sulfonylchlorid |
| 1,4-Bromnaphthalinsulfonsaeurechlorid |
| 4-bromo-naphthalene-1-sulfonyl chloride |
| 4-Bromo-1-naphthalenesulfonyl chloride |
