Introduction：Basic information about CAS 75176-37-3|Zofenoprilat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zofenoprilat |
|---|
| CAS Number | 75176-37-3 | Molecular Weight | 325.446 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 556.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H19NO3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 290.2±30.1 °C |
|---|
Names
| Name | zofenoprilat |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 556.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H19NO3S2 |
|---|
| Molecular Weight | 325.446 |
|---|
| Flash Point | 290.2±30.1 °C |
|---|
| Exact Mass | 325.080627 |
|---|
| PSA | 121.71000 |
|---|
| LogP | 2.14 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | UQWLOWFDKAFKAP-WXHSDQCUSA-N |
|---|
| SMILES | CC(CS)C(=O)N1CC(Sc2ccccc2)CC1C(=O)O |
|---|
Synonyms
| Zofenoprilat |
| (4S)-1-[(2S)-3-Mercapto-2-methyl-1-oxopropyl]-4-(phenylthio)-L-proline |
| L-Proline, 1-[(2R)-3-mercapto-2-methyl-1-oxopropyl]-4-(phenylthio)-, (4S)- |
| [1(S),4(S)]-1-(3-Mercapto-2-methyl-1-oxopropyl)-4-phenyl-thio-L-proline |
| (2s,4s)-1-[(2r)-2-methyl-3-sulfanyl-propanoyl]-4-phenylsulfanyl-pyrrolidine-2-carboxylic acid |
| (1(r*),2alpha,4alpha)-1-(3-mercapto-2-methyl-1-oxopropyl)-4-(phenylthio)-l-proline |
| [1(R*),2a,4a]-1-(3-Mercapto-2-methyl-1-oxopropyl)-4-(phenylthio)-L-proline |
| (4S)-1-[(2R)-2-Methyl-3-sulfanylpropanoyl]-4-(phenylsulfanyl)-L-proline |
| (4S)-1-[(2S)-3-mercapto-2-methylpropanoyl]-4-(phenylthio)-L-proline |
