Introduction：Basic information about CAS 344298-99-3|dl-propranolol-d7 (ring-d7), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dl-propranolol-d7 (ring-d7) |
|---|
| CAS Number | 344298-99-3 | Molecular Weight | 266.387 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 434.9±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14D7NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.8±24.6 °C |
|---|
| Symbol |
GHS02, GHS06, GHS08 | Signal Word | Danger |
|---|
Names
| Name | dl-propranolol-d7 (ring-d7) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 434.9±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14D7NO2 |
|---|
| Molecular Weight | 266.387 |
|---|
| Flash Point | 216.8±24.6 °C |
|---|
| Exact Mass | 266.201172 |
|---|
| PSA | 41.49000 |
|---|
| LogP | 3.10 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | AQHHHDLHHXJYJD-MIBSYSDMSA-N |
|---|
| SMILES | CC(C)NCC(O)COc1cccc2ccccc12 |
|---|
| Storage condition | ?20°C |
|---|
Safety Information
| Symbol |
GHS02, GHS06, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H301 + H311 + H331-H370 |
|---|
| Precautionary Statements | P210-P280-P302 + P352 + P312-P304 + P340 + P312-P370 + P378-P403 + P235 |
|---|
| Hazard Codes | F,T |
|---|
| Risk Phrases | 11-23/24/25-39/23/24/25 |
|---|
| Safety Phrases | 16-36/37-45 |
|---|
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
|---|
Synonyms
| 1-(Isopropylamino)-3-[(H)-1-naphthyloxy]propan-2-ol |
| Propranolol-d7 (ring-d7) |
| 2-Propanol, 1-[(1-methylethyl)amino]-3-(1-naphthalenyl-d-oxy)- |
| 1-(Isopropylamino)-3-[(H)-1-naphthyloxy]-2-propanol |
