Introduction：Basic information about CAS 34946-82-2|Copper(II) trifluoromethanesulphonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Copper(II) trifluoromethanesulphonate |
|---|
| CAS Number | 34946-82-2 | Molecular Weight | 361.684 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C2CuF6O6S2 | Melting Point | >=300 ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | copper,trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >=300 ºC |
|---|
| Molecular Formula | C2CuF6O6S2 |
|---|
| Molecular Weight | 361.684 |
|---|
| Exact Mass | 360.833649 |
|---|
| PSA | 103.50000 |
|---|
| LogP | 2.79290 |
|---|
| InChIKey | SBTSVTLGWRLWOD-UHFFFAOYSA-L |
|---|
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Cu+2] |
|---|
Safety Information
| Hazard Codes | Xi;C |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45-27 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 8.0 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Trifluoromethanesulfonic acid copper(II) salt |
| EINECS 252-300-8 |
| copper trifluoromethanesulfonate |
| Copper (II) Trifluoromethanesulfonate |
| Methanesulfonic acid, 1,1,1-trifluoro-, copper(2+) salt (2:1) |
| copper(II) triflate |
| Copper(2+) bis(trifluoromethanesulfonate) |
| Copper(II) triflate (Cu(OTf)2 |
| Copper(II) trifluoromethanesulfonate |
| MFCD00077492 |
| Cu(OTf)2 |
| Cupric trifluoromethanesulfonate |
| copper,trifluoromethanesulfonate |
