Introduction：Basic information about CAS 5814-37-9|Ethyl 4-(4-methylphenyl)-2,4-dioxobutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-(4-methylphenyl)-2,4-dioxobutanoate |
|---|
| CAS Number | 5814-37-9 | Molecular Weight | 234.248 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 369.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.9±23.2 °C |
|---|
Names
| Name | Ethyl 4-(4-methylphenyl)-2,4-dioxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 369.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14O4 |
|---|
| Molecular Weight | 234.248 |
|---|
| Flash Point | 163.9±23.2 °C |
|---|
| Exact Mass | 234.089203 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 1.99 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | QQMYOPVSVNPECO-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(C)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| ethyl 2,4-dioxo-4-p-tolylbutanoate |
| 2,4-Dioxo-4-p-tolyl-buttersaeure-aethylester |
| Ethyl 4-methyl-a,g-dioxo-benzenebutanoate |
| Benzenebutanoic acid, 4-methyl-α,γ-dioxo-, ethyl ester |
| Ethyl 4-(4-methylphenyl)-2,4-dioxobutanoate |
| 2,4-dioxo-4-p-tolyl-butyric acid ethyl ester |
