Introduction：Basic information about CAS 2848-01-3|3-(Diphenylphosphino)propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Diphenylphosphino)propionic acid |
|---|
| CAS Number | 2848-01-3 | Molecular Weight | 258.25200 |
|---|
| Density | 1.290±0.06 g/cm3 | Boiling Point | 89-90 °C(Press: 0.2 Torr) |
|---|
| Molecular Formula | C15H15O2P | Melting Point | 90-94 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-diphenylphosphanylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.290±0.06 g/cm3 |
|---|
| Boiling Point | 89-90 °C(Press: 0.2 Torr) |
|---|
| Melting Point | 90-94 °C(lit.) |
|---|
| Molecular Formula | C15H15O2P |
|---|
| Molecular Weight | 258.25200 |
|---|
| Exact Mass | 258.08100 |
|---|
| PSA | 50.89000 |
|---|
| LogP | 2.59400 |
|---|
| InChIKey | OTSIFUHGOBFOTH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCP(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Safety Phrases | 26-36/37/39-45-39-37-36-A26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (2-Carboxyethyl)diphenylphosphine |
| 3-(diphenylphosphino)propanoic acid |
| (2-Carboxyethyl)diphenylphosphine 4,4-Diphenyl-4-phosphabutanoic acid |
| 3-diphenyl-phosphanyl-propanoic acid |
| 3-(DIPHENYLPHOSPHINO)PROPIONIC ACID |
| 3-diphenylphosphinoyl-propanoic acid |
