Introduction:Basic information about CAS 64309-39-3|2-(N,N-dipropyl)amino-5,6-dihydroxytetralin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(N,N-dipropyl)amino-5,6-dihydroxytetralin |
|---|
| CAS Number | 64309-39-3 | Molecular Weight | 263.37500 |
|---|
| Density | 1.11g/cm3 | Boiling Point | 413.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H25NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.2ºC |
|---|
Names
| Name | 6-(Dipropylamino)-5,6,7,8-tetrahydro-1,2-naphthalenediol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.11g/cm3 |
|---|
| Boiling Point | 413.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H25NO2 |
|---|
| Molecular Weight | 263.37500 |
|---|
| Flash Point | 202.2ºC |
|---|
| Exact Mass | 263.18900 |
|---|
| PSA | 43.70000 |
|---|
| LogP | 3.07710 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | JQHSYAQISCFWOK-UHFFFAOYSA-N |
|---|
| SMILES | CCCN(CCC)C1CCc2c(ccc(O)c2O)C1 |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (1)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo(de,g)quinoline |
| (+/-)-5,6-dihydroxy-DPAT |
| 2 (dipropylamino) 1,2,3,4 tetrahydronaphthalene 5,6 diol |
| 2-(N,N-Dipropylamino)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalene |
| (+/-)-glaucine |
| 5,6-dihydroxy-2-(di-n-propylamino)tetralin |
| 1,2,9,10-tetramethoxyaporphine |
| 5,6-dihydroxy-2-(N,N-di-n-propylamino)tetralin |
| rac-1,2,9,10-tetramethoxy-6-methyl-aporphane |
| glaucine phosphate |
| 5,6-dihydroxy-2-di-n-propylamino-1,2,3,4-tetrahydronaphthalene |
| lauroscholtzine |
| tussiglaucin |
| (+/-)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline |