Introduction:Basic information about CAS 188404-34-4|(S)-N-(Butoxycarbonyl)-4-aminophenylalaninol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-N-(Butoxycarbonyl)-4-aminophenylalaninol |
|---|
| CAS Number | 188404-34-4 | Molecular Weight | 266.33600 |
|---|
| Density | 1.139 | Boiling Point | 482ºC at 760 mmHg |
|---|
| Molecular Formula | C14H22N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 245.3ºC |
|---|
Names
| Name | butyl N-[1-(4-aminophenyl)-3-hydroxypropan-2-yl]carbamate |
|---|
Chemical & Physical Properties
| Density | 1.139 |
|---|
| Boiling Point | 482ºC at 760 mmHg |
|---|
| Molecular Formula | C14H22N2O3 |
|---|
| Molecular Weight | 266.33600 |
|---|
| Flash Point | 245.3ºC |
|---|
| Exact Mass | 266.16300 |
|---|
| PSA | 88.07000 |
|---|
| LogP | 2.48410 |
|---|
| Vapour Pressure | 4.21E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | OSUKKPIXRGNCBB-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOC(=O)NC(CO)Cc1ccc(N)cc1 |
|---|