Introduction：Basic information about CAS 188489-07-8|flufenpyr-ethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | flufenpyr-ethyl |
|---|
| CAS Number | 188489-07-8 | Molecular Weight | 408.73200 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 440.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H13ClF4N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220ºC |
|---|
Names
| Name | flufenpyr-ethyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 440.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H13ClF4N2O4 |
|---|
| Molecular Weight | 408.73200 |
|---|
| Flash Point | 220ºC |
|---|
| Exact Mass | 408.05000 |
|---|
| PSA | 70.42000 |
|---|
| LogP | 3.29410 |
|---|
| Vapour Pressure | 6.05E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | DNUAYCRATWAJQE-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)COc1cc(-n2ncc(C(F)(F)F)c(C)c2=O)c(F)cc1Cl |
|---|
Synonyms
| ethyl {2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1(6H)-yl]phenoxy}acetate |
| ethyl 2-chloro-5-[1,6-dihydro-5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-fluorophenoxyacetate |
| ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate |
| ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)-1(6H)-pyridazinyl]phenoxy]acetate |
| Flufenpyr-ethyl |
