Introduction:Basic information about CAS 97825-07-5|[Thi5,8,DPhe7] Bradykinin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [Thi5,8,DPhe7] Bradykinin |
|---|
| CAS Number | 97825-07-5 | Molecular Weight | 1122.323 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C50H71N15O11S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (β-(2-THIENYL)-ALA5,8,D-PHE7)-BRADYKININ |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Molecular Formula | C50H71N15O11S2 |
|---|
| Molecular Weight | 1122.323 |
|---|
| Exact Mass | 1121.489868 |
|---|
| PSA | 479.05000 |
|---|
| LogP | 0.27 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | JRBHAUUWUHNRJJ-INZKOXSASA-N |
|---|
| SMILES | NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NCC(=O)NC(Cc1cccs1)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cccs1)C(=O)NC(CCCN=C(N)N)C(=O)O |
|---|
Synonyms
| npc-431 |
| N-(Diaminomethylene)-L-ornithyl-L-prolyl-L-prolylglycyl-3-(2-thienyl)-L-alanyl-L-seryl-D-phenylalanyl-3-(2-thienyl)-L-alanyl-N-(diaminomethylene)-L-ornithine |
| L-Ornithine, N-(diaminomethylene)-L-ornithyl-L-prolyl-L-prolylglycyl-3-(2-thienyl)-L-alanyl-L-seryl-D-phenylalanyl-3-(2-thienyl)-L-alanyl-N-(diaminomethylene)- |
| arg-pro-pro-gly-thi-ser-d-phe-thi-arg 2acoh 4h2o |
| arg-pro-pro-gly-thi-ser-d-phe-thi-arg |
| [Thi5,8,DPhe7] Bradykinin |