Introduction:Basic information about CAS 6486-27-7|N-(2,4-dimethylphenyl)-2-[(4-methyl-2-nitrophenyl)azo]-3-oxobutyramide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2,4-dimethylphenyl)-2-[(4-methyl-2-nitrophenyl)azo]-3-oxobutyramide |
|---|
| CAS Number | 6486-27-7 | Molecular Weight | 368.38700 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 541.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.2ºC |
|---|
Names
| Name | N-(2,4-dimethylphenyl)-2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxobutanamide |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 541.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N4O4 |
|---|
| Molecular Weight | 368.38700 |
|---|
| Flash Point | 281.2ºC |
|---|
| Exact Mass | 368.14800 |
|---|
| PSA | 120.20000 |
|---|
| LogP | 5.37270 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | LYXFVDLRJONRTM-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(N=Nc1ccc(C)cc1[N+](=O)[O-])C(=O)Nc1ccc(C)cc1C |
|---|