Introduction:Basic information about CAS 6487-92-9|[3,4,5-triacetyloxy-6-[(2-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl aceta, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [3,4,5-triacetyloxy-6-[(2-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|
| CAS Number | 6487-92-9 | Molecular Weight | 527.50200 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 600.6ºC at 760 mmHg |
|---|
| Molecular Formula | C21H25N3O11S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.1ºC |
|---|
Names
| Name | [3,4,5-triacetyloxy-6-[(2-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 600.6ºC at 760 mmHg |
|---|
| Molecular Formula | C21H25N3O11S |
|---|
| Molecular Weight | 527.50200 |
|---|
| Flash Point | 317.1ºC |
|---|
| Exact Mass | 527.12100 |
|---|
| PSA | 223.44000 |
|---|
| LogP | 2.09890 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | ZKTDCXQBMTWBNZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCC1OC(NC(=S)Nc2ccccc2[N+](=O)[O-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|---|