Introduction：Basic information about CAS 7134-13-6|2,4-dimethoxybenzenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-dimethoxybenzenesulfonic acid |
|---|
| CAS Number | 7134-13-6 | Molecular Weight | 218.22700 |
|---|
| Density | 1.362g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H10O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,4-dimethoxybenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.362g/cm3 |
|---|
| Molecular Formula | C8H10O5S |
|---|
| Molecular Weight | 218.22700 |
|---|
| Exact Mass | 218.02500 |
|---|
| PSA | 81.21000 |
|---|
| LogP | 2.03130 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | ZPHMCVPMYLSOJH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(=O)(=O)O)c(OC)c1 |
|---|
Synonyms
| 2,4-Dimethoxy-benzolsulfonsaeure |
| 2,4-dimethoxy-benzenesulfonic acid |
| 1,3-Dimethoxy-benzol-4-sulfonsaeure |
| 2,4-Dimethoxy-benzol-1-sulfonsaeure |
| Benzenesulfonic acid,2,4-dimethoxy |
