Introduction:Basic information about CAS 98185-17-2|1-(4,6-dichloro-1,3,5-triazin-2-yl)azepane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)azepane |
|---|
| CAS Number | 98185-17-2 | Molecular Weight | 247.12400 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 421.7ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12Cl2N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.9ºC |
|---|
Names
| Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)azepane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 421.7ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12Cl2N4 |
|---|
| Molecular Weight | 247.12400 |
|---|
| Flash Point | 208.9ºC |
|---|
| Exact Mass | 246.04400 |
|---|
| PSA | 41.91000 |
|---|
| LogP | 2.62380 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | ILCNAEYNPUDNHG-UHFFFAOYSA-N |
|---|
| SMILES | Clc1nc(Cl)nc(N2CCCCCC2)n1 |
|---|
Synonyms
| 2,4-Dichloro-6-(hexahydro-1-azepinyl)-s-triazine |
| 1H-Azepine,1-(4,6-dichloro-1,3,5-triazin-2-yl)hexahydro-(9CI) |
| s-Triazine,2,4-dichloro-6-(hexahydro-1-azepinyl) |
| 1H-Azepine,1-(4,6-dichloro-1,3,5-triazin-2-yl)hexahydro |