Introduction：Basic information about CAS 1851-09-8|4-Chlorobenzenesulphonylacetonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chlorobenzenesulphonylacetonitrile |
|---|
| CAS Number | 1851-09-8 | Molecular Weight | 215.657 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 421.3±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO2S | Melting Point | 168-172 °C |
|---|
| MSDS | / | Flash Point | 208.6±28.7 °C |
|---|
Names
| Name | 2-(4-chlorophenyl)sulfonylacetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 421.3±45.0 °C at 760 mmHg |
|---|
| Melting Point | 168-172 °C |
|---|
| Molecular Formula | C8H6ClNO2S |
|---|
| Molecular Weight | 215.657 |
|---|
| Flash Point | 208.6±28.7 °C |
|---|
| Exact Mass | 214.980774 |
|---|
| PSA | 66.31000 |
|---|
| LogP | 0.86 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | HAQGVGPNKGGSMK-UHFFFAOYSA-N |
|---|
| SMILES | N#CCS(=O)(=O)c1ccc(Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S37/39 |
|---|
| RIDADR | 3276 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-((4-Chlorophenyl)sulfonyl)acetonitrile |
| 4-Chlorophenyl CyanoMethyl Sulfone |
| 4-Chlorobenzenesulphonylacetonitrile |
| p-CHLOROPHENYLSULFONYLACETONITRILE |
| [(4-Chlorophenyl)sulfonyl]acetonitrile |
| p-chlorophenylsulfonyl-cyanomethane |
| Acetonitrile, 2-[(4-chlorophenyl)sulfonyl]- |
| MFCD00045626 |
| 4-Chlorophenylsulfonylacetonitrile |
| 2-[(4-chlorophenyl)sulfonyl]acetonitrile |
