Introduction：Basic information about CAS 333408-47-2|2-(3-Fluorophenyl)-4-thiazolidinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-Fluorophenyl)-4-thiazolidinecarboxylic acid |
|---|
| CAS Number | 333408-47-2 | Molecular Weight | 227.25500 |
|---|
| Density | 1.378 | Boiling Point | 425.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10FNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.378 |
|---|
| Boiling Point | 425.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10FNO2S |
|---|
| Molecular Weight | 227.25500 |
|---|
| Exact Mass | 227.04200 |
|---|
| PSA | 74.63000 |
|---|
| LogP | 1.94270 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | ZCIDMBKXEBMSLH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CSC(c2cccc(F)c2)N1 |
|---|
