Introduction：Basic information about CAS 62516-09-0|3,5-dibromo-4-nitro-1-oxidopyridin-1-ium, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-dibromo-4-nitro-1-oxidopyridin-1-ium |
|---|
| CAS Number | 62516-09-0 | Molecular Weight | 297.88900 |
|---|
| Density | 2.42 g/cm3 | Boiling Point | 391.8ºC at 760 mmHg |
|---|
| Molecular Formula | C5H2Br2N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.7ºC |
|---|
Names
| Name | 3,5-dibromo-4-nitro-1-oxidopyridin-1-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.42 g/cm3 |
|---|
| Boiling Point | 391.8ºC at 760 mmHg |
|---|
| Molecular Formula | C5H2Br2N2O3 |
|---|
| Molecular Weight | 297.88900 |
|---|
| Flash Point | 190.7ºC |
|---|
| Exact Mass | 295.84300 |
|---|
| PSA | 71.28000 |
|---|
| LogP | 3.07150 |
|---|
| Index of Refraction | 1.72 |
|---|
| InChIKey | MNPIOSXHEAIODW-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1c(Br)c[n+]([O-])cc1Br |
|---|
Synonyms
| 3,5-dibromo-4-nitro-pyridine 1-oxide |
| 3,5-Dibrom-4-nitro-pyridin-1-oxid |
| 3,5-Dibromo-4-nitropyridine-n-oxide |
