Introduction:Basic information about CAS 92138-35-7|6-Chloro-3-nitro-2-pyridinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-3-nitro-2-pyridinol |
|---|
| CAS Number | 92138-35-7 | Molecular Weight | 174.542 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 342.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H3ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.8±26.5 °C |
|---|
Names
| Name | 6-chloro-3-nitro-1H-pyridin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 342.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H3ClN2O3 |
|---|
| Molecular Weight | 174.542 |
|---|
| Flash Point | 160.8±26.5 °C |
|---|
| Exact Mass | 173.983215 |
|---|
| PSA | 78.94000 |
|---|
| LogP | 0.74 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | SCGNWULOSYKTQP-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c(Cl)ccc1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-chloro-3-nitropyridin-2-ol |
| 6-chloro-3-nitro-2H-pyridin-one |
| 6-Chloro-2-hydroxy-3-nitropyridine |
| 2-pyridinol, 6-chloro-3-nitro- |
| 6-Chloro-3-nitro-2-pyridinol |
| 2(1H)-Pyridinone, 6-chloro-3-nitro- |
| 6-chloro-3-nitro-2(1H)pyridone |
| 6-Chloro-3-nitro-2(1H)-pyridinone |
| 2-HYDROXY-3-NITRO-6-CHLOROPYRIDINE |
| 6-chloro-3-nitro-2-pyridone |