Introduction：Basic information about CAS 63758-12-3|2,3-Dihydro-1,4-benzodioxine-6-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-Dihydro-1,4-benzodioxine-6-sulfonyl chloride |
|---|
| CAS Number | 63758-12-3 | Molecular Weight | 234.657 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 344.2±41.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7ClO4S | Melting Point | 66ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 162.0±27.6 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 344.2±41.0 °C at 760 mmHg |
|---|
| Melting Point | 66ºC |
|---|
| Molecular Formula | C8H7ClO4S |
|---|
| Molecular Weight | 234.657 |
|---|
| Flash Point | 162.0±27.6 °C |
|---|
| Exact Mass | 233.975357 |
|---|
| PSA | 60.98000 |
|---|
| LogP | 2.70 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | JWHSRWUHRLYAPM-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)OCCO2 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Supplemental HS | Reacts violently with water. |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | C,Xi |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,4-Benzodioxin-6-sulfonyl chloride, 2,3-dihydro- |
| 1,4-Benzodioxane-6-sulfonyl chloride |
| MFCD02677681 |
| 2,3-Dihydro-1,4-benzodioxine-6-sulfonyl chloride |
| 2,3-dihydrobenzo[b][1,4]dioxine-6-sulfonyl chloride |
| 2,3-dihydro-benzo[1,4]dioxine-6-sulfonylchloride |
| 2H,3H-benzo[3,4-e]1,4-dioxin-6-ylchlorosulfone |
| 6-(Chlorosulphonyl)-2,3-dihydro-1,4-benzodioxine |
| 2,3-Dihydro-1,4-Benzodioxin-6-Sulfonylchloride |
| 2,3-dihydro-1,4-benzodioxin-6-ylsulphonyl chloride |
| 2,3-dihydro-benzo[1,4]dioxin-6-sulfonyl chloride |
| 3,4-ethylenedioxybenzenesulfonyl chloride |
| 6-chlorosulfonyl-benzo-1,4-dioxane |
| 2,3-DICHLORO BENZOYL ACETONITRILE |
| 2,3-dihydro-1,4-benzodioxine-6-sulphonyl chloride |
| 2,3-Dihydro-benzo[1,4]dioxin-6-sulfonylchlorid |
| 1,4-benzodioxan-6-sulfonyl chloride |
