Introduction:Basic information about CAS 651-84-3|4-trifluoromethyl-2,3,5,6-tetrafluorothiophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-trifluoromethyl-2,3,5,6-tetrafluorothiophenol |
|---|
| CAS Number | 651-84-3 | Molecular Weight | 250.13700 |
|---|
| Density | 1.66 | Boiling Point | 169 °C |
|---|
| Molecular Formula | C7HF7S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 60ºC |
|---|
Names
| Name | 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzenethiol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.66 |
|---|
| Boiling Point | 169 °C |
|---|
| Molecular Formula | C7HF7S |
|---|
| Molecular Weight | 250.13700 |
|---|
| Flash Point | 60ºC |
|---|
| Exact Mass | 249.96900 |
|---|
| PSA | 38.80000 |
|---|
| LogP | 3.55050 |
|---|
| Index of Refraction | 1.442-1.444 |
|---|
| InChIKey | BXMOMKVOHOSVJH-UHFFFAOYSA-N |
|---|
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1S |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Trifluoromethyl-2,3,5,6-tetrafluorothiophenol |
| 4-trifluoromethyl-2,3,5,6-tetrafluorobenzenethiol |
| 2,3,5,6-Tetrafluor-4-trifluormethyl-thiophenol |
| PC7769C |
| Perfluoro-p-thiocresol |
| 2,3,5,6-tetrafluoro-4-trifluoromethylbenzenethiol |
| 4-(Trifluoromethyl)tetrafluorothiophenol |
| MFCD00191594 |
| 4-CF3C6F4SH |
| H-p-SC6F4(CF3) |
| 2,3,5,6-tetrafluoro-4-trifluoromethylthiophenol |