Introduction:Basic information about CAS 92-41-1|naphthalene-2,7-disulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | naphthalene-2,7-disulfonic acid |
|---|
| CAS Number | 92-41-1 | Molecular Weight | 288.29700 |
|---|
| Density | 1.704 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H8O6S2 | Melting Point | 80-84 °C(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | naphthalene-2,7-disulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.704 g/cm3 |
|---|
| Melting Point | 80-84 °C(lit.) |
|---|
| Molecular Formula | C10H8O6S2 |
|---|
| Molecular Weight | 288.29700 |
|---|
| Exact Mass | 287.97600 |
|---|
| PSA | 125.50000 |
|---|
| LogP | 3.49480 |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | VILFVXYKHXVYAB-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc2ccc(S(=O)(=O)O)cc2c1 |
|---|
Safety Information
| RIDADR | 1759 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904100000 |
|---|
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 202-154-6 |
| MFCD00035734 |
| Naphthalene-2,7-disulphonic acid |
| 2,7-Naphthalene disulfonic acid |
| Naphthalin-disulfonsaeure-(2.7) |
| ebert-merz a-acid |
| naphthalene-2,7-disulfonate |
| 2,7-naphthalenedisulphonic acid |
| Naphthalin-2,7-disulfonsaeure |
| Naphthalene-2,7-disulfonic acid |